C27H36NO — CID 102307966
CID 102307966 (PubChem CID 102307966) has the molecular formula C27H36NO and a molecular weight of 390.59 g/mol.
| Compound Name | CID 102307966 |
|---|---|
| PubChem CID | 102307966 |
| Molecular Formula | C27H36NO |
| Molecular Weight | 390.59 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(N([O])CC#Cc2ccccc2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C27H36NO/c1-25(2,3)21-18-22(26(4,5)6)24(23(19-21)27(7,8)9)28(29)17-13-16-20-14-11-10-12-15-20/h10-12,14-15,18-19H,17H2,1-9H3 |
| InChIKey | HWCFDVKXUMEWJZ-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 23.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.59 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|