C17H10F6 — CID 54756772
1-(3-phenylprop-2-ynyl)-3,5-bis(trifluoromethyl)benzene (PubChem CID 54756772) has the molecular formula C17H10F6 and a molecular weight of 328.26 g/mol. Its IUPAC name is 1-(3-phenylprop-2-ynyl)-3,5-bis(trifluoromethyl)benzene.
| Compound Name | 1-(3-phenylprop-2-ynyl)-3,5-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 54756772 |
| Molecular Formula | C17H10F6 |
| Molecular Weight | 328.26 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 1-(3-phenylprop-2-ynyl)-3,5-bis(trifluoromethyl)benzene |
| SMILES | FC(F)(F)c1cc(CC#Cc2ccccc2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H10F6/c18-16(19,20)14-9-13(10-15(11-14)17(21,22)23)8-4-7-12-5-2-1-3-6-12/h1-3,5-6,9-11H,8H2 |
| InChIKey | SQLURLGXSDMDFY-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.26 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|