C25H16F6O2 — CID 164665766
1,4-diphenylbut-3-yn-2-yl 3,5-bis(trifluoromethyl)benzoate (PubChem CID 164665766) has the molecular formula C25H16F6O2 and a molecular weight of 462.39 g/mol. Its IUPAC name is 1,4-diphenylbut-3-yn-2-yl 3,5-bis(trifluoromethyl)benzoate.
| Compound Name | 1,4-diphenylbut-3-yn-2-yl 3,5-bis(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 164665766 |
| Molecular Formula | C25H16F6O2 |
| Molecular Weight | 462.39 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | 1,4-diphenylbut-3-yn-2-yl 3,5-bis(trifluoromethyl)benzoate |
| SMILES | O=C(OC(C#Cc1ccccc1)Cc1ccccc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H16F6O2/c26-24(27,28)20-14-19(15-21(16-20)25(29,30)31)23(32)33-22(13-18-9-5-2-6-10-18)12-11-17-7-3-1-4-8-17/h1-10,14-16,22H,13H2 |
| InChIKey | FJEJVWYHMAADMZ-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.39 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|