C20H16F6O — CID 72722618
2-benzyl-1-[3,5-bis(trifluoromethyl)phenyl]pent-4-en-1-one (PubChem CID 72722618) has the molecular formula C20H16F6O and a molecular weight of 386.34 g/mol. Its IUPAC name is 2-benzyl-1-[3,5-bis(trifluoromethyl)phenyl]pent-4-en-1-one.
| Compound Name | 2-benzyl-1-[3,5-bis(trifluoromethyl)phenyl]pent-4-en-1-one |
|---|---|
| PubChem CID | 72722618 |
| Molecular Formula | C20H16F6O |
| Molecular Weight | 386.34 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 2-benzyl-1-[3,5-bis(trifluoromethyl)phenyl]pent-4-en-1-one |
| SMILES | C=CCC(Cc1ccccc1)C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H16F6O/c1-2-6-14(9-13-7-4-3-5-8-13)18(27)15-10-16(19(21,22)23)12-17(11-15)20(24,25)26/h2-5,7-8,10-12,14H,1,6,9H2 |
| InChIKey | FVUSCCFSMHQIRD-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.34 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|