C39H35F6NOP+ — CID 162539906
[(2S)-2-[[3,5-bis(trifluoromethyl)benzoyl]amino]-3-phenylpropyl]-tris(4-methylphenyl)phosphanium (PubChem CID 162539906) has the molecular formula C39H35F6NOP+ and a molecular weight of 678.68 g/mol. Its IUPAC name is [(2S)-2-[[3,5-bis(trifluoromethyl)benzoyl]amino]-3-phenylpropyl]-tris(4-methylphenyl)phosphanium.
| Compound Name | [(2S)-2-[[3,5-bis(trifluoromethyl)benzoyl]amino]-3-phenylpropyl]-tris(4-methylphenyl)phosphanium |
|---|---|
| PubChem CID | 162539906 |
| Molecular Formula | C39H35F6NOP+ |
| Molecular Weight | 678.68 g/mol |
| Exact Mass | 678.24 |
| IUPAC Name | [(2S)-2-[[3,5-bis(trifluoromethyl)benzoyl]amino]-3-phenylpropyl]-tris(4-methylphenyl)phosphanium |
| SMILES | Cc1ccc([P+](C[C@H](Cc2ccccc2)NC(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)(c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C39H34F6NOP/c1-26-9-15-34(16-10-26)48(35-17-11-27(2)12-18-35,36-19-13-28(3)14-20-36)25-33(21-29-7-5-4-6-8-29)46-37(47)30-22-31(38(40,41)42)24-32(23-30)39(43,44)45/h4-20,22-24,33H,21,25H2,1-3H3/p+1/t33-/m0/s1 |
| InChIKey | IRDIRZOQLHICSL-XIFFEERXSA-O |
| XLogP | 8.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.68 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|