C28H29BrF6NOP — CID 164676856
N-[(2S)-1-(bromo-methyl-diphenyl-λ5-phosphanyl)-4-methylpentan-2-yl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 164676856) has the molecular formula C28H29BrF6NOP and a molecular weight of 620.41 g/mol. Its IUPAC name is N-[(2S)-1-(bromo-methyl-diphenyl-λ5-phosphanyl)-4-methylpentan-2-yl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[(2S)-1-(bromo-methyl-diphenyl-λ5-phosphanyl)-4-methylpentan-2-yl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 164676856 |
| Molecular Formula | C28H29BrF6NOP |
| Molecular Weight | 620.41 g/mol |
| Exact Mass | 619.11 |
| IUPAC Name | N-[(2S)-1-(bromo-methyl-diphenyl-λ5-phosphanyl)-4-methylpentan-2-yl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | CC(C)C[C@@H](CP(C)(Br)(c1ccccc1)c1ccccc1)NC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H29BrF6NOP/c1-19(2)14-23(18-38(3,29,24-10-6-4-7-11-24)25-12-8-5-9-13-25)36-26(37)20-15-21(27(30,31)32)17-22(16-20)28(33,34)35/h4-13,15-17,19,23H,14,18H2,1-3H3,(H,36,37)/t23-/m0/s1 |
| InChIKey | AOGVPMONXHHZSB-QHCPKHFHSA-N |
| XLogP | 8.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.41 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|