C32H29BrF6NOP — CID 164679353
N-[(2S)-1-[bromo(triphenyl)-λ5-phosphanyl]-3-methylbutan-2-yl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 164679353) has the molecular formula C32H29BrF6NOP and a molecular weight of 668.46 g/mol. Its IUPAC name is N-[(2S)-1-[bromo(triphenyl)-λ5-phosphanyl]-3-methylbutan-2-yl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[(2S)-1-[bromo(triphenyl)-λ5-phosphanyl]-3-methylbutan-2-yl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 164679353 |
| Molecular Formula | C32H29BrF6NOP |
| Molecular Weight | 668.46 g/mol |
| Exact Mass | 667.11 |
| IUPAC Name | N-[(2S)-1-[bromo(triphenyl)-λ5-phosphanyl]-3-methylbutan-2-yl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | CC(C)[C@@H](CP(Br)(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C32H29BrF6NOP/c1-22(2)29(40-30(41)23-18-24(31(34,35)36)20-25(19-23)32(37,38)39)21-42(33,26-12-6-3-7-13-26,27-14-8-4-9-15-27)28-16-10-5-11-17-28/h3-20,22,29H,21H2,1-2H3,(H,40,41)/t29-/m1/s1 |
| InChIKey | DFJGORJBVLJAJG-GDLZYMKVSA-N |
| XLogP | 8.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.46 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|