C15H18F6N2O — CID 129289013
N-[(2S)-1-amino-3,3-dimethylbutan-2-yl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 129289013) has the molecular formula C15H18F6N2O and a molecular weight of 356.31 g/mol. Its IUPAC name is N-[(2S)-1-amino-3,3-dimethylbutan-2-yl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[(2S)-1-amino-3,3-dimethylbutan-2-yl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 129289013 |
| Molecular Formula | C15H18F6N2O |
| Molecular Weight | 356.31 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | N-[(2S)-1-amino-3,3-dimethylbutan-2-yl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | CC(C)(C)[C@@H](CN)NC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H18F6N2O/c1-13(2,3)11(7-22)23-12(24)8-4-9(14(16,17)18)6-10(5-8)15(19,20)21/h4-6,11H,7,22H2,1-3H3,(H,23,24)/t11-/m1/s1 |
| InChIKey | COCXQWCGSXPPIJ-LLVKDONJSA-N |
| XLogP | 3.83 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.31 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |