C28H26F8 — CID 143472298
fluoroethene;1-[(1S)-1-(4-fluorophenyl)-2-phenylethyl]-3,5-bis(trifluoromethyl)benzene;2-methylprop-1-ene (PubChem CID 143472298) has the molecular formula C28H26F8 and a molecular weight of 514.50 g/mol. Its IUPAC name is fluoroethene;1-[(1S)-1-(4-fluorophenyl)-2-phenylethyl]-3,5-bis(trifluoromethyl)benzene;2-methylprop-1-ene.
| Compound Name | fluoroethene;1-[(1S)-1-(4-fluorophenyl)-2-phenylethyl]-3,5-bis(trifluoromethyl)benzene;2-methylprop-1-ene |
|---|---|
| PubChem CID | 143472298 |
| Molecular Formula | C28H26F8 |
| Molecular Weight | 514.50 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | fluoroethene;1-[(1S)-1-(4-fluorophenyl)-2-phenylethyl]-3,5-bis(trifluoromethyl)benzene;2-methylprop-1-ene |
| SMILES | C=C(C)C.C=CF.Fc1ccc([C@H](Cc2ccccc2)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C22H15F7.C4H8.C2H3F/c23-19-8-6-15(7-9-19)20(10-14-4-2-1-3-5-14)16-11-17(21(24,25)26)13-18(12-16)22(27,28)29;1-4(2)3;1-2-3/h1-9,11-13,20H,10H2;1H2,2-3H3;2H,1H2/t20-;;/m0../s1 |
| InChIKey | BURACFSEYZOMQV-FJSYBICCSA-N |
| XLogP | 9.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.50 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|