C23H18F5N — CID 143471976
N-[(1R)-1-(4-fluorophenyl)-1-[3-fluoro-5-(trifluoromethyl)phenyl]-2-phenylethyl]ethanimine (PubChem CID 143471976) has the molecular formula C23H18F5N and a molecular weight of 403.39 g/mol. Its IUPAC name is N-[(1R)-1-(4-fluorophenyl)-1-[3-fluoro-5-(trifluoromethyl)phenyl]-2-phenylethyl]ethanimine.
| Compound Name | N-[(1R)-1-(4-fluorophenyl)-1-[3-fluoro-5-(trifluoromethyl)phenyl]-2-phenylethyl]ethanimine |
|---|---|
| PubChem CID | 143471976 |
| Molecular Formula | C23H18F5N |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | N-[(1R)-1-(4-fluorophenyl)-1-[3-fluoro-5-(trifluoromethyl)phenyl]-2-phenylethyl]ethanimine |
| SMILES | C/C=N/[C@](Cc1ccccc1)(c1ccc(F)cc1)c1cc(F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H18F5N/c1-2-29-22(15-16-6-4-3-5-7-16,17-8-10-20(24)11-9-17)18-12-19(23(26,27)28)14-21(25)13-18/h2-14H,15H2,1H3/b29-2+/t22-/m1/s1 |
| InChIKey | RJKADRCEIGINKR-ULGVFGSDSA-N |
| XLogP | 6.56 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|