C20H15F6NO2 — CID 175569093
2-benzyl-2-[[3,5-bis(trifluoromethyl)phenyl]methylideneamino]but-3-enoic acid (PubChem CID 175569093) has the molecular formula C20H15F6NO2 and a molecular weight of 415.33 g/mol. Its IUPAC name is 2-benzyl-2-[[3,5-bis(trifluoromethyl)phenyl]methylideneamino]but-3-enoic acid.
| Compound Name | 2-benzyl-2-[[3,5-bis(trifluoromethyl)phenyl]methylideneamino]but-3-enoic acid |
|---|---|
| PubChem CID | 175569093 |
| Molecular Formula | C20H15F6NO2 |
| Molecular Weight | 415.33 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 2-benzyl-2-[[3,5-bis(trifluoromethyl)phenyl]methylideneamino]but-3-enoic acid |
| SMILES | C=CC(Cc1ccccc1)(/N=C/c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(=O)O |
| InChI | InChI=1S/C20H15F6NO2/c1-2-18(17(28)29,11-13-6-4-3-5-7-13)27-12-14-8-15(19(21,22)23)10-16(9-14)20(24,25)26/h2-10,12H,1,11H2,(H,28,29)/b27-12+ |
| InChIKey | ADTDJIQFNCIYMV-KKMKTNMSSA-N |
| XLogP | 5.40 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.33 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|