C21H21F2NO2 — CID 87214110
(2S)-2-(benzhydrylideneamino)-5-cyclopropyl-4,4-difluoropentanoic acid (PubChem CID 87214110) has the molecular formula C21H21F2NO2 and a molecular weight of 357.40 g/mol. Its IUPAC name is (2S)-2-(benzhydrylideneamino)-5-cyclopropyl-4,4-difluoropentanoic acid.
| Compound Name | (2S)-2-(benzhydrylideneamino)-5-cyclopropyl-4,4-difluoropentanoic acid |
|---|---|
| PubChem CID | 87214110 |
| Molecular Formula | C21H21F2NO2 |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | (2S)-2-(benzhydrylideneamino)-5-cyclopropyl-4,4-difluoropentanoic acid |
| SMILES | O=C(O)[C@H](CC(F)(F)CC1CC1)N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H21F2NO2/c22-21(23,13-15-11-12-15)14-18(20(25)26)24-19(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-10,15,18H,11-14H2,(H,25,26)/t18-/m0/s1 |
| InChIKey | RWESXJDKQKETQO-SFHVURJKSA-N |
| XLogP | 4.80 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.40 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|