C23H16F13NO2 — CID 164888057
methyl 3-(benzhydrylideneamino)-4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononanoate (PubChem CID 164888057) has the molecular formula C23H16F13NO2 and a molecular weight of 585.36 g/mol. Its IUPAC name is methyl 3-(benzhydrylideneamino)-4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononanoate.
| Compound Name | methyl 3-(benzhydrylideneamino)-4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononanoate |
|---|---|
| PubChem CID | 164888057 |
| Molecular Formula | C23H16F13NO2 |
| Molecular Weight | 585.36 g/mol |
| Exact Mass | 585.10 |
| IUPAC Name | methyl 3-(benzhydrylideneamino)-4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononanoate |
| SMILES | COC(=O)CC(N=C(c1ccccc1)c1ccccc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C23H16F13NO2/c1-39-16(38)12-15(37-17(13-8-4-2-5-9-13)14-10-6-3-7-11-14)18(24,25)19(26,27)20(28,29)21(30,31)22(32,33)23(34,35)36/h2-11,15H,12H2,1H3 |
| InChIKey | HPSOYBVRJNIWKP-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.36 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|