C16H16F7NO2 — CID 10738948
ethyl (3R)-4,4,5,5,6,6,6-heptafluoro-3-(1-phenylethylideneamino)hexanoate (PubChem CID 10738948) has the molecular formula C16H16F7NO2 and a molecular weight of 387.30 g/mol. Its IUPAC name is ethyl (3R)-4,4,5,5,6,6,6-heptafluoro-3-(1-phenylethylideneamino)hexanoate.
| Compound Name | ethyl (3R)-4,4,5,5,6,6,6-heptafluoro-3-(1-phenylethylideneamino)hexanoate |
|---|---|
| PubChem CID | 10738948 |
| Molecular Formula | C16H16F7NO2 |
| Molecular Weight | 387.30 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | ethyl (3R)-4,4,5,5,6,6,6-heptafluoro-3-(1-phenylethylideneamino)hexanoate |
| SMILES | CCOC(=O)C[C@@H](/N=C(\C)c1ccccc1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H16F7NO2/c1-3-26-13(25)9-12(14(17,18)15(19,20)16(21,22)23)24-10(2)11-7-5-4-6-8-11/h4-8,12H,3,9H2,1-2H3/b24-10+/t12-/m1/s1 |
| InChIKey | HJOIYESVEUUSJE-LYORIEDSSA-N |
| XLogP | 4.65 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.30 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|