C25H23F8NO4 — CID 164888081
1-O-methyl 6-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 3-(benzhydrylideneamino)hexanedioate (PubChem CID 164888081) has the molecular formula C25H23F8NO4 and a molecular weight of 553.45 g/mol. Its IUPAC name is 1-O-methyl 6-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 3-(benzhydrylideneamino)hexanedioate.
| Compound Name | 1-O-methyl 6-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 3-(benzhydrylideneamino)hexanedioate |
|---|---|
| PubChem CID | 164888081 |
| Molecular Formula | C25H23F8NO4 |
| Molecular Weight | 553.45 g/mol |
| Exact Mass | 553.15 |
| IUPAC Name | 1-O-methyl 6-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 3-(benzhydrylideneamino)hexanedioate |
| SMILES | COC(=O)CC(CCC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F)N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H23F8NO4/c1-37-20(36)14-18(34-21(16-8-4-2-5-9-16)17-10-6-3-7-11-17)12-13-19(35)38-15-23(28,29)25(32,33)24(30,31)22(26)27/h2-11,18,22H,12-15H2,1H3 |
| InChIKey | BSUAODXMEWAWKB-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.45 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|