C24H18F13NO2 — CID 164888124
methyl 4-(benzhydrylideneamino)-5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecanoate (PubChem CID 164888124) has the molecular formula C24H18F13NO2 and a molecular weight of 599.39 g/mol. Its IUPAC name is methyl 4-(benzhydrylideneamino)-5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecanoate.
| Compound Name | methyl 4-(benzhydrylideneamino)-5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecanoate |
|---|---|
| PubChem CID | 164888124 |
| Molecular Formula | C24H18F13NO2 |
| Molecular Weight | 599.39 g/mol |
| Exact Mass | 599.11 |
| IUPAC Name | methyl 4-(benzhydrylideneamino)-5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecanoate |
| SMILES | COC(=O)CCC(N=C(c1ccccc1)c1ccccc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C24H18F13NO2/c1-40-17(39)13-12-16(38-18(14-8-4-2-5-9-14)15-10-6-3-7-11-15)19(25,26)20(27,28)21(29,30)22(31,32)23(33,34)24(35,36)37/h2-11,16H,12-13H2,1H3 |
| InChIKey | ONVXGNDEZVHDRZ-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.39 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|