C27H26F3NO2 — CID 10950488
tert-butyl (2S)-2-(benzhydrylideneamino)-3-[4-(trifluoromethyl)phenyl]propanoate (PubChem CID 10950488) has the molecular formula C27H26F3NO2 and a molecular weight of 453.50 g/mol. Its IUPAC name is tert-butyl (2S)-2-(benzhydrylideneamino)-3-[4-(trifluoromethyl)phenyl]propanoate.
| Compound Name | tert-butyl (2S)-2-(benzhydrylideneamino)-3-[4-(trifluoromethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 10950488 |
| Molecular Formula | C27H26F3NO2 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | tert-butyl (2S)-2-(benzhydrylideneamino)-3-[4-(trifluoromethyl)phenyl]propanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](Cc1ccc(C(F)(F)F)cc1)N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H26F3NO2/c1-26(2,3)33-25(32)23(18-19-14-16-22(17-15-19)27(28,29)30)31-24(20-10-6-4-7-11-20)21-12-8-5-9-13-21/h4-17,23H,18H2,1-3H3/t23-/m0/s1 |
| InChIKey | QQEHWAMJENHNFX-QHCPKHFHSA-N |
| XLogP | 6.50 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|