C25H26FNO2 — CID 11143656
tert-butyl (2S)-3-(2-fluorophenyl)-2-methyl-2-(naphthalen-2-ylmethylideneamino)propanoate (PubChem CID 11143656) has the molecular formula C25H26FNO2 and a molecular weight of 391.49 g/mol. Its IUPAC name is tert-butyl (2S)-3-(2-fluorophenyl)-2-methyl-2-(naphthalen-2-ylmethylideneamino)propanoate.
| Compound Name | tert-butyl (2S)-3-(2-fluorophenyl)-2-methyl-2-(naphthalen-2-ylmethylideneamino)propanoate |
|---|---|
| PubChem CID | 11143656 |
| Molecular Formula | C25H26FNO2 |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | tert-butyl (2S)-3-(2-fluorophenyl)-2-methyl-2-(naphthalen-2-ylmethylideneamino)propanoate |
| SMILES | CC(C)(C)OC(=O)[C@](C)(Cc1ccccc1F)/N=C/c1ccc2ccccc2c1 |
| InChI | InChI=1S/C25H26FNO2/c1-24(2,3)29-23(28)25(4,16-21-11-7-8-12-22(21)26)27-17-18-13-14-19-9-5-6-10-20(19)15-18/h5-15,17H,16H2,1-4H3/b27-17+/t25-/m0/s1 |
| InChIKey | XUTXBJPMXUVVHO-YYYGAUAXSA-N |
| XLogP | 5.74 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|