C25H22F3NO2 — CID 154721176
ethyl (E)-2-(benzylideneamino)-5-naphthalen-1-yl-2-(trifluoromethyl)pent-4-enoate (PubChem CID 154721176) has the molecular formula C25H22F3NO2 and a molecular weight of 425.45 g/mol. Its IUPAC name is ethyl (E)-2-(benzylideneamino)-5-naphthalen-1-yl-2-(trifluoromethyl)pent-4-enoate.
| Compound Name | ethyl (E)-2-(benzylideneamino)-5-naphthalen-1-yl-2-(trifluoromethyl)pent-4-enoate |
|---|---|
| PubChem CID | 154721176 |
| Molecular Formula | C25H22F3NO2 |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | ethyl (E)-2-(benzylideneamino)-5-naphthalen-1-yl-2-(trifluoromethyl)pent-4-enoate |
| SMILES | CCOC(=O)C(C/C=C/c1cccc2ccccc12)(/N=C/c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C25H22F3NO2/c1-2-31-23(30)24(25(26,27)28,29-18-19-10-4-3-5-11-19)17-9-15-21-14-8-13-20-12-6-7-16-22(20)21/h3-16,18H,2,17H2,1H3/b15-9+,29-18+ |
| InChIKey | AMPNRNYWHVPMFA-DKQNVHDASA-N |
| XLogP | 6.23 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|