C21H25NO2 — CID 11131129
tert-butyl (2S)-2-methyl-2-(naphthalen-2-ylmethylideneamino)pent-4-enoate (PubChem CID 11131129) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is tert-butyl (2S)-2-methyl-2-(naphthalen-2-ylmethylideneamino)pent-4-enoate.
| Compound Name | tert-butyl (2S)-2-methyl-2-(naphthalen-2-ylmethylideneamino)pent-4-enoate |
|---|---|
| PubChem CID | 11131129 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | tert-butyl (2S)-2-methyl-2-(naphthalen-2-ylmethylideneamino)pent-4-enoate |
| SMILES | C=CC[C@](C)(/N=C/c1ccc2ccccc2c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H25NO2/c1-6-13-21(5,19(23)24-20(2,3)4)22-15-16-11-12-17-9-7-8-10-18(17)14-16/h6-12,14-15H,1,13H2,2-5H3/b22-15+/t21-/m0/s1 |
| InChIKey | DBMBLRJUPXHTDU-FNNTWHHHSA-N |
| XLogP | 4.94 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|