C29H29NO2 — CID 10949916
tert-butyl (2S)-2-methyl-3-naphthalen-1-yl-2-(naphthalen-2-ylmethylideneamino)propanoate (PubChem CID 10949916) has the molecular formula C29H29NO2 and a molecular weight of 423.56 g/mol. Its IUPAC name is tert-butyl (2S)-2-methyl-3-naphthalen-1-yl-2-(naphthalen-2-ylmethylideneamino)propanoate.
| Compound Name | tert-butyl (2S)-2-methyl-3-naphthalen-1-yl-2-(naphthalen-2-ylmethylideneamino)propanoate |
|---|---|
| PubChem CID | 10949916 |
| Molecular Formula | C29H29NO2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | tert-butyl (2S)-2-methyl-3-naphthalen-1-yl-2-(naphthalen-2-ylmethylideneamino)propanoate |
| SMILES | CC(C)(C)OC(=O)[C@](C)(Cc1cccc2ccccc12)/N=C/c1ccc2ccccc2c1 |
| InChI | InChI=1S/C29H29NO2/c1-28(2,3)32-27(31)29(4,19-25-14-9-13-23-11-7-8-15-26(23)25)30-20-21-16-17-22-10-5-6-12-24(22)18-21/h5-18,20H,19H2,1-4H3/b30-20+/t29-/m0/s1 |
| InChIKey | OLSLHJSZKLFPHM-INFHVPRLSA-N |
| XLogP | 6.76 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|