C25H25F2NO2 — CID 11112341
tert-butyl (2S)-3-(2,6-difluorophenyl)-2-methyl-2-(naphthalen-2-ylmethylideneamino)propanoate (PubChem CID 11112341) has the molecular formula C25H25F2NO2 and a molecular weight of 409.48 g/mol. Its IUPAC name is tert-butyl (2S)-3-(2,6-difluorophenyl)-2-methyl-2-(naphthalen-2-ylmethylideneamino)propanoate.
| Compound Name | tert-butyl (2S)-3-(2,6-difluorophenyl)-2-methyl-2-(naphthalen-2-ylmethylideneamino)propanoate |
|---|---|
| PubChem CID | 11112341 |
| Molecular Formula | C25H25F2NO2 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | tert-butyl (2S)-3-(2,6-difluorophenyl)-2-methyl-2-(naphthalen-2-ylmethylideneamino)propanoate |
| SMILES | CC(C)(C)OC(=O)[C@](C)(Cc1c(F)cccc1F)/N=C/c1ccc2ccccc2c1 |
| InChI | InChI=1S/C25H25F2NO2/c1-24(2,3)30-23(29)25(4,15-20-21(26)10-7-11-22(20)27)28-16-17-12-13-18-8-5-6-9-19(18)14-17/h5-14,16H,15H2,1-4H3/b28-16+/t25-/m0/s1 |
| InChIKey | ZVYZOMXFMDEVBD-SXFMOBQTSA-N |
| XLogP | 5.88 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|