C26H26FNO2 — CID 11304230
tert-butyl (2S)-2-(benzhydrylideneamino)-3-(4-fluorophenyl)propanoate (PubChem CID 11304230) has the molecular formula C26H26FNO2 and a molecular weight of 403.50 g/mol. Its IUPAC name is tert-butyl (2S)-2-(benzhydrylideneamino)-3-(4-fluorophenyl)propanoate.
| Compound Name | tert-butyl (2S)-2-(benzhydrylideneamino)-3-(4-fluorophenyl)propanoate |
|---|---|
| PubChem CID | 11304230 |
| Molecular Formula | C26H26FNO2 |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | tert-butyl (2S)-2-(benzhydrylideneamino)-3-(4-fluorophenyl)propanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](Cc1ccc(F)cc1)N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H26FNO2/c1-26(2,3)30-25(29)23(18-19-14-16-22(27)17-15-19)28-24(20-10-6-4-7-11-20)21-12-8-5-9-13-21/h4-17,23H,18H2,1-3H3/t23-/m0/s1 |
| InChIKey | HHNLXSLYQJRJOD-QHCPKHFHSA-N |
| XLogP | 5.62 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|