C32H29F2NO2 — CID 134833439
tert-butyl (2S)-2-(benzhydrylideneamino)-3,3-bis(4-fluorophenyl)propanoate (PubChem CID 134833439) has the molecular formula C32H29F2NO2 and a molecular weight of 497.59 g/mol. Its IUPAC name is tert-butyl (2S)-2-(benzhydrylideneamino)-3,3-bis(4-fluorophenyl)propanoate.
| Compound Name | tert-butyl (2S)-2-(benzhydrylideneamino)-3,3-bis(4-fluorophenyl)propanoate |
|---|---|
| PubChem CID | 134833439 |
| Molecular Formula | C32H29F2NO2 |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | tert-butyl (2S)-2-(benzhydrylideneamino)-3,3-bis(4-fluorophenyl)propanoate |
| SMILES | CC(C)(C)OC(=O)[C@@H](N=C(c1ccccc1)c1ccccc1)C(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C32H29F2NO2/c1-32(2,3)37-31(36)30(35-29(24-10-6-4-7-11-24)25-12-8-5-9-13-25)28(22-14-18-26(33)19-15-22)23-16-20-27(34)21-17-23/h4-21,28,30H,1-3H3/t30-/m0/s1 |
| InChIKey | AHYBTWXPYHXBDQ-PMERELPUSA-N |
| XLogP | 7.34 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|