C34H32FNO3 — CID 132548172
tert-butyl (2S,3R)-2-(benzhydrylideneamino)-5-(4-fluorophenyl)-5-oxo-3-phenylpentanoate (PubChem CID 132548172) has the molecular formula C34H32FNO3 and a molecular weight of 521.63 g/mol. Its IUPAC name is tert-butyl (2S,3R)-2-(benzhydrylideneamino)-5-(4-fluorophenyl)-5-oxo-3-phenylpentanoate.
| Compound Name | tert-butyl (2S,3R)-2-(benzhydrylideneamino)-5-(4-fluorophenyl)-5-oxo-3-phenylpentanoate |
|---|---|
| PubChem CID | 132548172 |
| Molecular Formula | C34H32FNO3 |
| Molecular Weight | 521.63 g/mol |
| Exact Mass | 521.24 |
| IUPAC Name | tert-butyl (2S,3R)-2-(benzhydrylideneamino)-5-(4-fluorophenyl)-5-oxo-3-phenylpentanoate |
| SMILES | CC(C)(C)OC(=O)[C@@H](N=C(c1ccccc1)c1ccccc1)[C@H](CC(=O)c1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C34H32FNO3/c1-34(2,3)39-33(38)32(36-31(26-15-9-5-10-16-26)27-17-11-6-12-18-27)29(24-13-7-4-8-14-24)23-30(37)25-19-21-28(35)22-20-25/h4-22,29,32H,23H2,1-3H3/t29-,32+/m1/s1 |
| InChIKey | ZBCHXZUCSWZKRC-PPTMTGTBSA-N |
| XLogP | 7.43 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.63 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|