C34H31F2NO3 — CID 164678845
tert-butyl (2S,3R)-2-(benzhydrylideneamino)-3,5-bis(4-fluorophenyl)-5-oxopentanoate (PubChem CID 164678845) has the molecular formula C34H31F2NO3 and a molecular weight of 539.62 g/mol. Its IUPAC name is tert-butyl (2S,3R)-2-(benzhydrylideneamino)-3,5-bis(4-fluorophenyl)-5-oxopentanoate.
| Compound Name | tert-butyl (2S,3R)-2-(benzhydrylideneamino)-3,5-bis(4-fluorophenyl)-5-oxopentanoate |
|---|---|
| PubChem CID | 164678845 |
| Molecular Formula | C34H31F2NO3 |
| Molecular Weight | 539.62 g/mol |
| Exact Mass | 539.23 |
| IUPAC Name | tert-butyl (2S,3R)-2-(benzhydrylideneamino)-3,5-bis(4-fluorophenyl)-5-oxopentanoate |
| SMILES | CC(C)(C)OC(=O)[C@@H](N=C(c1ccccc1)c1ccccc1)[C@H](CC(=O)c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C34H31F2NO3/c1-34(2,3)40-33(39)32(37-31(25-10-6-4-7-11-25)26-12-8-5-9-13-26)29(23-14-18-27(35)19-15-23)22-30(38)24-16-20-28(36)21-17-24/h4-21,29,32H,22H2,1-3H3/t29-,32+/m1/s1 |
| InChIKey | GAFBBEPCTIXLIQ-PPTMTGTBSA-N |
| XLogP | 7.57 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.62 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|