C28H29NO3 — CID 134944008
tert-butyl (2R)-2-(benzhydrylideneamino)-5-oxo-5-phenylpentanoate (PubChem CID 134944008) has the molecular formula C28H29NO3 and a molecular weight of 427.54 g/mol. Its IUPAC name is tert-butyl (2R)-2-(benzhydrylideneamino)-5-oxo-5-phenylpentanoate.
| Compound Name | tert-butyl (2R)-2-(benzhydrylideneamino)-5-oxo-5-phenylpentanoate |
|---|---|
| PubChem CID | 134944008 |
| Molecular Formula | C28H29NO3 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | tert-butyl (2R)-2-(benzhydrylideneamino)-5-oxo-5-phenylpentanoate |
| SMILES | CC(C)(C)OC(=O)[C@@H](CCC(=O)c1ccccc1)N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H29NO3/c1-28(2,3)32-27(31)24(19-20-25(30)21-13-7-4-8-14-21)29-26(22-15-9-5-10-16-22)23-17-11-6-12-18-23/h4-18,24H,19-20H2,1-3H3/t24-/m1/s1 |
| InChIKey | NITZFONIGWQYQG-XMMPIXPASA-N |
| XLogP | 5.90 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|