C22H22F3NO2 — CID 154721173
ethyl (E)-2-(benzylideneamino)-5-(4-methylphenyl)-2-(trifluoromethyl)pent-4-enoate (PubChem CID 154721173) has the molecular formula C22H22F3NO2 and a molecular weight of 389.42 g/mol. Its IUPAC name is ethyl (E)-2-(benzylideneamino)-5-(4-methylphenyl)-2-(trifluoromethyl)pent-4-enoate.
| Compound Name | ethyl (E)-2-(benzylideneamino)-5-(4-methylphenyl)-2-(trifluoromethyl)pent-4-enoate |
|---|---|
| PubChem CID | 154721173 |
| Molecular Formula | C22H22F3NO2 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | ethyl (E)-2-(benzylideneamino)-5-(4-methylphenyl)-2-(trifluoromethyl)pent-4-enoate |
| SMILES | CCOC(=O)C(C/C=C/c1ccc(C)cc1)(/N=C/c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C22H22F3NO2/c1-3-28-20(27)21(22(23,24)25,26-16-19-8-5-4-6-9-19)15-7-10-18-13-11-17(2)12-14-18/h4-14,16H,3,15H2,1-2H3/b10-7+,26-16+ |
| InChIKey | XUZYQXBKHNBQCO-YQDLVZDASA-N |
| XLogP | 5.38 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|