C27H43NO2 — CID 118714921
methyl (Z)-12-[(3-methylphenyl)methylideneamino]octadec-9-enoate (PubChem CID 118714921) has the molecular formula C27H43NO2 and a molecular weight of 413.65 g/mol. Its IUPAC name is methyl (Z)-12-[(3-methylphenyl)methylideneamino]octadec-9-enoate.
| Compound Name | methyl (Z)-12-[(3-methylphenyl)methylideneamino]octadec-9-enoate |
|---|---|
| PubChem CID | 118714921 |
| Molecular Formula | C27H43NO2 |
| Molecular Weight | 413.65 g/mol |
| Exact Mass | 413.33 |
| IUPAC Name | methyl (Z)-12-[(3-methylphenyl)methylideneamino]octadec-9-enoate |
| SMILES | CCCCCCC(C/C=C\CCCCCCCC(=O)OC)/N=C/c1cccc(C)c1 |
| InChI | InChI=1S/C27H43NO2/c1-4-5-6-13-19-26(28-23-25-18-16-17-24(2)22-25)20-14-11-9-7-8-10-12-15-21-27(29)30-3/h11,14,16-18,22-23,26H,4-10,12-13,15,19-21H2,1-3H3/b14-11-,28-23+ |
| InChIKey | NCCMKXCYIDDLPY-WQWFDTIYSA-N |
| XLogP | 7.60 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.65 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|