C15H18F3NO2 — CID 10733036
propan-2-yl (3R)-4,4,4-trifluoro-3-(1-phenylethylideneamino)butanoate (PubChem CID 10733036) has the molecular formula C15H18F3NO2 and a molecular weight of 301.31 g/mol. Its IUPAC name is propan-2-yl (3R)-4,4,4-trifluoro-3-(1-phenylethylideneamino)butanoate.
| Compound Name | propan-2-yl (3R)-4,4,4-trifluoro-3-(1-phenylethylideneamino)butanoate |
|---|---|
| PubChem CID | 10733036 |
| Molecular Formula | C15H18F3NO2 |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | propan-2-yl (3R)-4,4,4-trifluoro-3-(1-phenylethylideneamino)butanoate |
| SMILES | C/C(=N\[C@H](CC(=O)OC(C)C)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C15H18F3NO2/c1-10(2)21-14(20)9-13(15(16,17)18)19-11(3)12-7-5-4-6-8-12/h4-8,10,13H,9H2,1-3H3/b19-11+/t13-/m1/s1 |
| InChIKey | IAUSDBPVFHFKBN-OTGIAGGSSA-N |
| XLogP | 3.77 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|