C16H20F3NO2 — CID 134870382
(4R)-5,5,5-trifluoro-4-(1-phenylethylideneamino)-1-propan-2-yloxypentan-2-one (PubChem CID 134870382) has the molecular formula C16H20F3NO2 and a molecular weight of 315.33 g/mol. Its IUPAC name is (4R)-5,5,5-trifluoro-4-(1-phenylethylideneamino)-1-propan-2-yloxypentan-2-one.
| Compound Name | (4R)-5,5,5-trifluoro-4-(1-phenylethylideneamino)-1-propan-2-yloxypentan-2-one |
|---|---|
| PubChem CID | 134870382 |
| Molecular Formula | C16H20F3NO2 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | (4R)-5,5,5-trifluoro-4-(1-phenylethylideneamino)-1-propan-2-yloxypentan-2-one |
| SMILES | C/C(=N\[C@H](CC(=O)COC(C)C)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C16H20F3NO2/c1-11(2)22-10-14(21)9-15(16(17,18)19)20-12(3)13-7-5-4-6-8-13/h4-8,11,15H,9-10H2,1-3H3/b20-12+/t15-/m1/s1 |
| InChIKey | FFTHFKMESMZYJP-RVZJCZPVSA-N |
| XLogP | 3.81 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|