C16H18F3NO2 — CID 13044053
4-[[[3-(trifluoromethyl)phenyl]methylideneamino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 13044053) has the molecular formula C16H18F3NO2 and a molecular weight of 313.32 g/mol. Its IUPAC name is 4-[[[3-(trifluoromethyl)phenyl]methylideneamino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[[3-(trifluoromethyl)phenyl]methylideneamino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 13044053 |
| Molecular Formula | C16H18F3NO2 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 4-[[[3-(trifluoromethyl)phenyl]methylideneamino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(C/N=C/c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C16H18F3NO2/c17-16(18,19)14-3-1-2-12(8-14)10-20-9-11-4-6-13(7-5-11)15(21)22/h1-3,8,10-11,13H,4-7,9H2,(H,21,22)/b20-10+ |
| InChIKey | DMVZTAOIYHQVOS-KEBDBYFISA-N |
| XLogP | 4.02 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|