C16H17F6NO2 — CID 89124104
(2S)-4,4-difluoro-6-methyl-2-[[2,2,2-trifluoro-1-(4-fluorophenyl)ethylidene]amino]heptanoic acid (PubChem CID 89124104) has the molecular formula C16H17F6NO2 and a molecular weight of 369.31 g/mol. Its IUPAC name is (2S)-4,4-difluoro-6-methyl-2-[[2,2,2-trifluoro-1-(4-fluorophenyl)ethylidene]amino]heptanoic acid.
| Compound Name | (2S)-4,4-difluoro-6-methyl-2-[[2,2,2-trifluoro-1-(4-fluorophenyl)ethylidene]amino]heptanoic acid |
|---|---|
| PubChem CID | 89124104 |
| Molecular Formula | C16H17F6NO2 |
| Molecular Weight | 369.31 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | (2S)-4,4-difluoro-6-methyl-2-[[2,2,2-trifluoro-1-(4-fluorophenyl)ethylidene]amino]heptanoic acid |
| SMILES | CC(C)CC(F)(F)C[C@H](/N=C(\c1ccc(F)cc1)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C16H17F6NO2/c1-9(2)7-15(18,19)8-12(14(24)25)23-13(16(20,21)22)10-3-5-11(17)6-4-10/h3-6,9,12H,7-8H2,1-2H3,(H,24,25)/b23-13+/t12-/m0/s1 |
| InChIKey | LSUCASRCGKSINW-SJXGOUHISA-N |
| XLogP | 4.70 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.31 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|