C22H16F3NO2 — CID 87753024
2-(benzhydrylideneamino)-3-(3,4,5-trifluorophenyl)propanoic acid (PubChem CID 87753024) has the molecular formula C22H16F3NO2 and a molecular weight of 383.37 g/mol. Its IUPAC name is 2-(benzhydrylideneamino)-3-(3,4,5-trifluorophenyl)propanoic acid.
| Compound Name | 2-(benzhydrylideneamino)-3-(3,4,5-trifluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 87753024 |
| Molecular Formula | C22H16F3NO2 |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 2-(benzhydrylideneamino)-3-(3,4,5-trifluorophenyl)propanoic acid |
| SMILES | O=C(O)C(Cc1cc(F)c(F)c(F)c1)N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H16F3NO2/c23-17-11-14(12-18(24)20(17)25)13-19(22(27)28)26-21(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-12,19H,13H2,(H,27,28) |
| InChIKey | QWXACJVWBGYRSM-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|