C26H23FN2O2 — CID 134938870
methyl (2S,3R)-2-(benzhydrylideneamino)-3-(3-fluorophenyl)-3-(prop-2-enylideneamino)propanoate (PubChem CID 134938870) has the molecular formula C26H23FN2O2 and a molecular weight of 414.48 g/mol. Its IUPAC name is methyl (2S,3R)-2-(benzhydrylideneamino)-3-(3-fluorophenyl)-3-(prop-2-enylideneamino)propanoate.
| Compound Name | methyl (2S,3R)-2-(benzhydrylideneamino)-3-(3-fluorophenyl)-3-(prop-2-enylideneamino)propanoate |
|---|---|
| PubChem CID | 134938870 |
| Molecular Formula | C26H23FN2O2 |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | methyl (2S,3R)-2-(benzhydrylideneamino)-3-(3-fluorophenyl)-3-(prop-2-enylideneamino)propanoate |
| SMILES | C=C/C=N/[C@H](c1cccc(F)c1)[C@H](N=C(c1ccccc1)c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C26H23FN2O2/c1-3-17-28-24(21-15-10-16-22(27)18-21)25(26(30)31-2)29-23(19-11-6-4-7-12-19)20-13-8-5-9-14-20/h3-18,24-25H,1H2,2H3/b28-17+/t24-,25+/m1/s1 |
| InChIKey | WYJDIUMBXUECGA-KOKHMRAOSA-N |
| XLogP | 5.20 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|