C20H13F6NO5 — CID 134590192
3-(1,3-dioxoisoindol-2-yl)oxypropyl 3,5-bis(trifluoromethyl)benzoate (PubChem CID 134590192) has the molecular formula C20H13F6NO5 and a molecular weight of 461.31 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)oxypropyl 3,5-bis(trifluoromethyl)benzoate.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)oxypropyl 3,5-bis(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 134590192 |
| Molecular Formula | C20H13F6NO5 |
| Molecular Weight | 461.31 g/mol |
| Exact Mass | 461.07 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)oxypropyl 3,5-bis(trifluoromethyl)benzoate |
| SMILES | O=C(OCCCON1C(=O)c2ccccc2C1=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H13F6NO5/c21-19(22,23)12-8-11(9-13(10-12)20(24,25)26)18(30)31-6-3-7-32-27-16(28)14-4-1-2-5-15(14)17(27)29/h1-2,4-5,8-10H,3,6-7H2 |
| InChIKey | BFWBRIACMYRWPZ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.31 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|