C16H8F3NO4 — CID 91726288
(1,3-dioxoisoindol-2-yl) 3-(trifluoromethyl)benzoate (PubChem CID 91726288) has the molecular formula C16H8F3NO4 and a molecular weight of 335.24 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl) 3-(trifluoromethyl)benzoate.
| Compound Name | (1,3-dioxoisoindol-2-yl) 3-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 91726288 |
| Molecular Formula | C16H8F3NO4 |
| Molecular Weight | 335.24 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl) 3-(trifluoromethyl)benzoate |
| SMILES | O=C(ON1C(=O)c2ccccc2C1=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H8F3NO4/c17-16(18,19)10-5-3-4-9(8-10)15(23)24-20-13(21)11-6-1-2-7-12(11)14(20)22/h1-8H |
| InChIKey | BNBDBVIQIHDTIL-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.24 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|