C17H13F6NO — CID 57100784
1-[3,5-bis(trifluoromethyl)phenyl]-N-phenylmethoxyethenamine (PubChem CID 57100784) has the molecular formula C17H13F6NO and a molecular weight of 361.29 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-N-phenylmethoxyethenamine.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-N-phenylmethoxyethenamine |
|---|---|
| PubChem CID | 57100784 |
| Molecular Formula | C17H13F6NO |
| Molecular Weight | 361.29 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-N-phenylmethoxyethenamine |
| SMILES | C=C(NOCc1ccccc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H13F6NO/c1-11(24-25-10-12-5-3-2-4-6-12)13-7-14(16(18,19)20)9-15(8-13)17(21,22)23/h2-9,24H,1,10H2 |
| InChIKey | MEHVQTCVYOLDMF-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.29 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|