C19H14Cl2F3N3O3 — CID 91298169
3-[2,6-dichloro-4-(trifluoromethyl)phenoxy]-5-methyl-N-phenylmethoxypyrazole-1-carboxamide (PubChem CID 91298169) has the molecular formula C19H14Cl2F3N3O3 and a molecular weight of 460.24 g/mol. Its IUPAC name is 3-[2,6-dichloro-4-(trifluoromethyl)phenoxy]-5-methyl-N-phenylmethoxypyrazole-1-carboxamide.
| Compound Name | 3-[2,6-dichloro-4-(trifluoromethyl)phenoxy]-5-methyl-N-phenylmethoxypyrazole-1-carboxamide |
|---|---|
| PubChem CID | 91298169 |
| Molecular Formula | C19H14Cl2F3N3O3 |
| Molecular Weight | 460.24 g/mol |
| Exact Mass | 459.04 |
| IUPAC Name | 3-[2,6-dichloro-4-(trifluoromethyl)phenoxy]-5-methyl-N-phenylmethoxypyrazole-1-carboxamide |
| SMILES | Cc1cc(Oc2c(Cl)cc(C(F)(F)F)cc2Cl)nn1C(=O)NOCc1ccccc1 |
| InChI | InChI=1S/C19H14Cl2F3N3O3/c1-11-7-16(30-17-14(20)8-13(9-15(17)21)19(22,23)24)25-27(11)18(28)26-29-10-12-5-3-2-4-6-12/h2-9H,10H2,1H3,(H,26,28) |
| InChIKey | PZTYBVNIXLSPIR-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.24 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|