C13H12F3N3O2 — CID 60668203
N-phenylmethoxy-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide (PubChem CID 60668203) has the molecular formula C13H12F3N3O2 and a molecular weight of 299.25 g/mol. Its IUPAC name is N-phenylmethoxy-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide.
| Compound Name | N-phenylmethoxy-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 60668203 |
| Molecular Formula | C13H12F3N3O2 |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | N-phenylmethoxy-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide |
| SMILES | O=C(Cn1ccc(C(F)(F)F)n1)NOCc1ccccc1 |
| InChI | InChI=1S/C13H12F3N3O2/c14-13(15,16)11-6-7-19(17-11)8-12(20)18-21-9-10-4-2-1-3-5-10/h1-7H,8-9H2,(H,18,20) |
| InChIKey | WUBQYFUEPJNTDO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|