C8H7F6N3O2 — CID 81341056
N-(2,2,2-trifluoroethoxy)-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide (PubChem CID 81341056) has the molecular formula C8H7F6N3O2 and a molecular weight of 291.15 g/mol. Its IUPAC name is N-(2,2,2-trifluoroethoxy)-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide.
| Compound Name | N-(2,2,2-trifluoroethoxy)-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 81341056 |
| Molecular Formula | C8H7F6N3O2 |
| Molecular Weight | 291.15 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | N-(2,2,2-trifluoroethoxy)-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide |
| SMILES | O=C(Cn1ccc(C(F)(F)F)n1)NOCC(F)(F)F |
| InChI | InChI=1S/C8H7F6N3O2/c9-7(10,11)4-19-16-6(18)3-17-2-1-5(15-17)8(12,13)14/h1-2H,3-4H2,(H,16,18) |
| InChIKey | CFQPUWGAMUZEBX-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.15 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|