C10H11F3N4O4 — CID 43357075
4-amino-4-oxo-2-[[2-[3-(trifluoromethyl)pyrazol-1-yl]acetyl]amino]butanoic acid (PubChem CID 43357075) has the molecular formula C10H11F3N4O4 and a molecular weight of 308.22 g/mol. Its IUPAC name is 4-amino-4-oxo-2-[[2-[3-(trifluoromethyl)pyrazol-1-yl]acetyl]amino]butanoic acid.
| Compound Name | 4-amino-4-oxo-2-[[2-[3-(trifluoromethyl)pyrazol-1-yl]acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 43357075 |
| Molecular Formula | C10H11F3N4O4 |
| Molecular Weight | 308.22 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 4-amino-4-oxo-2-[[2-[3-(trifluoromethyl)pyrazol-1-yl]acetyl]amino]butanoic acid |
| SMILES | NC(=O)CC(NC(=O)Cn1ccc(C(F)(F)F)n1)C(=O)O |
| InChI | InChI=1S/C10H11F3N4O4/c11-10(12,13)6-1-2-17(16-6)4-8(19)15-5(9(20)21)3-7(14)18/h1-2,5H,3-4H2,(H2,14,18)(H,15,19)(H,20,21) |
| InChIKey | UNSJYYFVPCLJPG-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.22 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |