C10H12F3N3O3 — CID 60812044
ethyl 2-[[2-[3-(trifluoromethyl)pyrazol-1-yl]acetyl]amino]acetate (PubChem CID 60812044) has the molecular formula C10H12F3N3O3 and a molecular weight of 279.22 g/mol. Its IUPAC name is ethyl 2-[[2-[3-(trifluoromethyl)pyrazol-1-yl]acetyl]amino]acetate.
| Compound Name | ethyl 2-[[2-[3-(trifluoromethyl)pyrazol-1-yl]acetyl]amino]acetate |
|---|---|
| PubChem CID | 60812044 |
| Molecular Formula | C10H12F3N3O3 |
| Molecular Weight | 279.22 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | ethyl 2-[[2-[3-(trifluoromethyl)pyrazol-1-yl]acetyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)Cn1ccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C10H12F3N3O3/c1-2-19-9(18)5-14-8(17)6-16-4-3-7(15-16)10(11,12)13/h3-4H,2,5-6H2,1H3,(H,14,17) |
| InChIKey | KJEVQEFHTCXZPY-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.22 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |