C16H13F6NO — CID 113341793
1-[3,5-bis(trifluoromethyl)phenyl]-N-phenylmethoxymethanamine (PubChem CID 113341793) has the molecular formula C16H13F6NO and a molecular weight of 349.27 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-N-phenylmethoxymethanamine.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-N-phenylmethoxymethanamine |
|---|---|
| PubChem CID | 113341793 |
| Molecular Formula | C16H13F6NO |
| Molecular Weight | 349.27 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-N-phenylmethoxymethanamine |
| SMILES | FC(F)(F)c1cc(CNOCc2ccccc2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H13F6NO/c17-15(18,19)13-6-12(7-14(8-13)16(20,21)22)9-23-24-10-11-4-2-1-3-5-11/h1-8,23H,9-10H2 |
| InChIKey | ZJDGCCKVTDKYFE-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.27 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|