C19H16O6 — CID 22594836
5-(1-phenylbut-3-en-2-yloxycarbonyl)benzene-1,3-dicarboxylic acid (PubChem CID 22594836) has the molecular formula C19H16O6 and a molecular weight of 340.33 g/mol. Its IUPAC name is 5-(1-phenylbut-3-en-2-yloxycarbonyl)benzene-1,3-dicarboxylic acid.
| Compound Name | 5-(1-phenylbut-3-en-2-yloxycarbonyl)benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 22594836 |
| Molecular Formula | C19H16O6 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 5-(1-phenylbut-3-en-2-yloxycarbonyl)benzene-1,3-dicarboxylic acid |
| SMILES | C=CC(Cc1ccccc1)OC(=O)c1cc(C(=O)O)cc(C(=O)O)c1 |
| InChI | InChI=1S/C19H16O6/c1-2-16(8-12-6-4-3-5-7-12)25-19(24)15-10-13(17(20)21)9-14(11-15)18(22)23/h2-7,9-11,16H,1,8H2,(H,20,21)(H,22,23) |
| InChIKey | HRNXUKVPLLNLOV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|