About 1-phenylbut-3-en-2-yl 2-[2-(4-methylphenyl)ethynyl]benzoate
1-phenylbut-3-en-2-yl 2-[2-(4-methylphenyl)ethynyl]benzoate (PubChem CID 139261789) has the molecular formula C26H22O2
and a molecular weight of 366.46 g/mol. Its IUPAC name is 1-phenylbut-3-en-2-yl 2-[2-(4-methylphenyl)ethynyl]benzoate.
Molecular Properties
| Compound Name | 1-phenylbut-3-en-2-yl 2-[2-(4-methylphenyl)ethynyl]benzoate |
| PubChem CID | 139261789 |
| Molecular Formula | C26H22O2 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 1-phenylbut-3-en-2-yl 2-[2-(4-methylphenyl)ethynyl]benzoate |
| SMILES | C=CC(Cc1ccccc1)OC(=O)c1ccccc1C#Cc1ccc(C)cc1 |
| InChI | InChI=1S/C26H22O2/c1-3-24(19-22-9-5-4-6-10-22)28-26(27)25-12-8-7-11-23(25)18-17-21-15-13-20(2)14-16-21/h3-16,24H,1,19H2,2H3 |
| InChIKey | HAGIPSBSLVVROO-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylbut-3-en-2-yl 2-[2-(4-methylphenyl)ethynyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylbut-3-en-2-yl 2-[2-(4-methylphenyl)ethynyl]benzoate?
The IUPAC name of 1-phenylbut-3-en-2-yl 2-[2-(4-methylphenyl)ethynyl]benzoate (CID 139261789) is 1-phenylbut-3-en-2-yl 2-[2-(4-methylphenyl)ethynyl]benzoate.
What is the SMILES notation for 1-phenylbut-3-en-2-yl 2-[2-(4-methylphenyl)ethynyl]benzoate?
The canonical SMILES for 1-phenylbut-3-en-2-yl 2-[2-(4-methylphenyl)ethynyl]benzoate is C=CC(Cc1ccccc1)OC(=O)c1ccccc1C#Cc1ccc(C)cc1.
What is the InChIKey of 1-phenylbut-3-en-2-yl 2-[2-(4-methylphenyl)ethynyl]benzoate?
The InChIKey is HAGIPSBSLVVROO-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H22O2/c1-3-24(19-22-9-5-4-6-10-22)28-26(27)25-12-8-7-11-23(25)18-17-21-15-13-20(2)14-16-21/h3-16,24H,1,19H2,2H3.
What are the key properties of 1-phenylbut-3-en-2-yl 2-[2-(4-methylphenyl)ethynyl]benzoate?
1-phenylbut-3-en-2-yl 2-[2-(4-methylphenyl)ethynyl]benzoate has a molecular weight of 366.46 g/mol, XLogP of 5.35, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylbut-3-en-2-yl 2-[2-(4-methylphenyl)ethynyl]benzoate is sourced from PubChem (CID 139261789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).