C14H9F3N2 — CID 86694420
6-(2-phenylethynyl)-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 86694420) has the molecular formula C14H9F3N2 and a molecular weight of 262.23 g/mol. Its IUPAC name is 6-(2-phenylethynyl)-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 6-(2-phenylethynyl)-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 86694420 |
| Molecular Formula | C14H9F3N2 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 6-(2-phenylethynyl)-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | Nc1cc(C(F)(F)F)cc(C#Cc2ccccc2)n1 |
| InChI | InChI=1S/C14H9F3N2/c15-14(16,17)11-8-12(19-13(18)9-11)7-6-10-4-2-1-3-5-10/h1-5,8-9H,(H2,18,19) |
| InChIKey | OFZNUYRKIOAYIY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|