C13H11F3N2 — CID 102716550
6-(2-methylphenyl)-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 102716550) has the molecular formula C13H11F3N2 and a molecular weight of 252.24 g/mol. Its IUPAC name is 6-(2-methylphenyl)-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 6-(2-methylphenyl)-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102716550 |
| Molecular Formula | C13H11F3N2 |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 6-(2-methylphenyl)-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | Cc1ccccc1-c1cc(C(F)(F)F)cc(N)n1 |
| InChI | InChI=1S/C13H11F3N2/c1-8-4-2-3-5-10(8)11-6-9(13(14,15)16)7-12(17)18-11/h2-7H,1H3,(H2,17,18) |
| InChIKey | QLZBZDGGAZEJHC-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |