C17H14F3N — CID 62338817
3-phenyl-N-[[3-(trifluoromethyl)phenyl]methyl]prop-2-yn-1-amine (PubChem CID 62338817) has the molecular formula C17H14F3N and a molecular weight of 289.30 g/mol. Its IUPAC name is 3-phenyl-N-[[3-(trifluoromethyl)phenyl]methyl]prop-2-yn-1-amine.
| Compound Name | 3-phenyl-N-[[3-(trifluoromethyl)phenyl]methyl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 62338817 |
| Molecular Formula | C17H14F3N |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 3-phenyl-N-[[3-(trifluoromethyl)phenyl]methyl]prop-2-yn-1-amine |
| SMILES | FC(F)(F)c1cccc(CNCC#Cc2ccccc2)c1 |
| InChI | InChI=1S/C17H14F3N/c18-17(19,20)16-10-4-8-15(12-16)13-21-11-5-9-14-6-2-1-3-7-14/h1-4,6-8,10,12,21H,11,13H2 |
| InChIKey | MGFRWPCEESSMMF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|