C29H35P — CID 54771244
1-phenylpenta-1,4-diyn-3-ylidene-(2,4,6-tritert-butylphenyl)phosphane (PubChem CID 54771244) has the molecular formula C29H35P and a molecular weight of 414.57 g/mol. Its IUPAC name is 1-phenylpenta-1,4-diyn-3-ylidene-(2,4,6-tritert-butylphenyl)phosphane.
| Compound Name | 1-phenylpenta-1,4-diyn-3-ylidene-(2,4,6-tritert-butylphenyl)phosphane |
|---|---|
| PubChem CID | 54771244 |
| Molecular Formula | C29H35P |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | 1-phenylpenta-1,4-diyn-3-ylidene-(2,4,6-tritert-butylphenyl)phosphane |
| SMILES | C#C/C(C#Cc1ccccc1)=P\c1c(C(C)(C)C)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C29H35P/c1-11-23(18-17-21-15-13-12-14-16-21)30-26-24(28(5,6)7)19-22(27(2,3)4)20-25(26)29(8,9)10/h1,12-16,19-20H,2-10H3 |
| InChIKey | NUKBAYWABUETFE-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|